C33H33FN2O8 — CID 168800315
2-[3-[7-fluoro-11-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]indeno[1,2-b]quinoxalin-11-yl]propanoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 168800315) has the molecular formula C33H33FN2O8 and a molecular weight of 604.63 g/mol. Its IUPAC name is 2-[3-[7-fluoro-11-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]indeno[1,2-b]quinoxalin-11-yl]propanoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-[7-fluoro-11-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]indeno[1,2-b]quinoxalin-11-yl]propanoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 168800315 |
| Molecular Formula | C33H33FN2O8 |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 604.22 |
| IUPAC Name | 2-[3-[7-fluoro-11-[3-[2-(2-methylprop-2-enoyloxy)ethoxy]-3-oxopropyl]indeno[1,2-b]quinoxalin-11-yl]propanoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCC1(CCC(=O)OCCOC(=O)C(=C)C)c2ccccc2-c2nc3cc(F)ccc3nc21 |
| InChI | InChI=1S/C33H33FN2O8/c1-20(2)31(39)43-17-15-41-27(37)11-13-33(14-12-28(38)42-16-18-44-32(40)21(3)4)24-8-6-5-7-23(24)29-30(33)36-25-10-9-22(34)19-26(25)35-29/h5-10,19H,1,3,11-18H2,2,4H3 |
| InChIKey | JCGJJGIRFZAWHE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 130.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|