C29H26O4 — CID 155331225
2-[3-(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)propanoyloxy]ethyl 2-methylprop-2-enoate (PubChem CID 155331225) has the molecular formula C29H26O4 and a molecular weight of 438.52 g/mol. Its IUPAC name is 2-[3-(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)propanoyloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[3-(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)propanoyloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155331225 |
| Molecular Formula | C29H26O4 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.18 |
| IUPAC Name | 2-[3-(1-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2,4,6,9,11,13,15,17,19-nonaenyl)propanoyloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCC12c3ccccc3C(c3ccccc31)c1ccccc12 |
| InChI | InChI=1S/C29H26O4/c1-19(2)28(31)33-18-17-32-26(30)15-16-29-23-12-6-3-9-20(23)27(21-10-4-7-13-24(21)29)22-11-5-8-14-25(22)29/h3-14,27H,1,15-18H2,2H3 |
| InChIKey | HMBCLFNEUNRGOZ-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|