C26H28O16 — CID 124894946
2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[(2R,3R,4R,5S,6R)-2,3,4,5-tetrahydroxy-6-[[(2S,3S,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one (PubChem CID 124894946) has the molecular formula C26H28O16 and a molecular weight of 596.49 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[(2R,3R,4R,5S,6R)-2,3,4,5-tetrahydroxy-6-[[(2S,3S,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[(2R,3R,4R,5S,6R)-2,3,4,5-tetrahydroxy-6-[[(2S,3S,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
|---|---|
| PubChem CID | 124894946 |
| Molecular Formula | C26H28O16 |
| Molecular Weight | 596.49 g/mol |
| Exact Mass | 596.14 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5-hydroxy-7-[(2R,3R,4R,5S,6R)-2,3,4,5-tetrahydroxy-6-[[(2S,3S,4S,5S)-3,4,5-trihydroxyoxan-2-yl]oxymethyl]oxan-2-yl]oxychromen-4-one |
| SMILES | O=c1cc(-c2ccc(O)c(O)c2)oc2cc(O[C@]3(O)O[C@H](CO[C@@H]4OC[C@H](O)[C@H](O)[C@@H]4O)[C@@H](O)[C@@H](O)[C@H]3O)cc(O)c12 |
| InChI | InChI=1S/C26H28O16/c27-11-2-1-9(3-12(11)28)16-6-14(30)19-13(29)4-10(5-17(19)40-16)41-26(37)24(36)22(34)21(33)18(42-26)8-39-25-23(35)20(32)15(31)7-38-25/h1-6,15,18,20-25,27-29,31-37H,7-8H2/t15-,18+,20-,21+,22+,23-,24+,25-,26-/m0/s1 |
| InChIKey | WQVCDQYJDQXJLY-AYTAIJGKSA-N |
| XLogP | -2.46 |
| TPSA | 269.43 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.49 |
| LogP ≤ 5 | -2.46 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|