C20H23NO7 — CID 124897822
N-[(2S,4aR,6S,7S,8S,8aR)-2-(furan-2-yl)-8-hydroxy-6-(4-methylphenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 124897822) has the molecular formula C20H23NO7 and a molecular weight of 389.40 g/mol. Its IUPAC name is N-[(2S,4aR,6S,7S,8S,8aR)-2-(furan-2-yl)-8-hydroxy-6-(4-methylphenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[(2S,4aR,6S,7S,8S,8aR)-2-(furan-2-yl)-8-hydroxy-6-(4-methylphenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 124897822 |
| Molecular Formula | C20H23NO7 |
| Molecular Weight | 389.40 g/mol |
| Exact Mass | 389.15 |
| IUPAC Name | N-[(2S,4aR,6S,7S,8S,8aR)-2-(furan-2-yl)-8-hydroxy-6-(4-methylphenoxy)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1[C@H](Oc2ccc(C)cc2)O[C@@H]2CO[C@H](c3ccco3)O[C@@H]2[C@H]1O |
| InChI | InChI=1S/C20H23NO7/c1-11-5-7-13(8-6-11)26-20-16(21-12(2)22)17(23)18-15(27-20)10-25-19(28-18)14-4-3-9-24-14/h3-9,15-20,23H,10H2,1-2H3,(H,21,22)/t15-,16+,17+,18+,19+,20-/m1/s1 |
| InChIKey | FJXGLXVROYMCBR-MPRNQXESSA-N |
| XLogP | 1.67 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |