C28H27NO8 — CID 18888066
N-[2-(furan-2-yl)-8-hydroxy-6-[2-[(E)-3-phenylprop-2-enoyl]phenoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 18888066) has the molecular formula C28H27NO8 and a molecular weight of 505.52 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-8-hydroxy-6-[2-[(E)-3-phenylprop-2-enoyl]phenoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[2-(furan-2-yl)-8-hydroxy-6-[2-[(E)-3-phenylprop-2-enoyl]phenoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 18888066 |
| Molecular Formula | C28H27NO8 |
| Molecular Weight | 505.52 g/mol |
| Exact Mass | 505.17 |
| IUPAC Name | N-[2-(furan-2-yl)-8-hydroxy-6-[2-[(E)-3-phenylprop-2-enoyl]phenoxy]-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CC(=O)NC1C(Oc2ccccc2C(=O)/C=C/c2ccccc2)OC2COC(c3ccco3)OC2C1O |
| InChI | InChI=1S/C28H27NO8/c1-17(30)29-24-25(32)26-23(16-34-27(37-26)22-12-7-15-33-22)36-28(24)35-21-11-6-5-10-19(21)20(31)14-13-18-8-3-2-4-9-18/h2-15,23-28,32H,16H2,1H3,(H,29,30)/b14-13+ |
| InChIKey | VGSSPSBVUOLBTK-BUHFOSPRSA-N |
| XLogP | 3.26 |
| TPSA | 116.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.52 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|