C23H23NO7 — CID 4629810
N-[2-(furan-2-yl)-8-hydroxy-6-naphthalen-2-yloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide (PubChem CID 4629810) has the molecular formula C23H23NO7 and a molecular weight of 425.44 g/mol. Its IUPAC name is N-[2-(furan-2-yl)-8-hydroxy-6-naphthalen-2-yloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide.
| Compound Name | N-[2-(furan-2-yl)-8-hydroxy-6-naphthalen-2-yloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
|---|---|
| PubChem CID | 4629810 |
| Molecular Formula | C23H23NO7 |
| Molecular Weight | 425.44 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | N-[2-(furan-2-yl)-8-hydroxy-6-naphthalen-2-yloxy-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-7-yl]acetamide |
| SMILES | CC(=O)NC1C(Oc2ccc3ccccc3c2)OC2COC(c3ccco3)OC2C1O |
| InChI | InChI=1S/C23H23NO7/c1-13(25)24-19-20(26)21-18(12-28-22(31-21)17-7-4-10-27-17)30-23(19)29-16-9-8-14-5-2-3-6-15(14)11-16/h2-11,18-23,26H,12H2,1H3,(H,24,25) |
| InChIKey | DKCLHHYCGQVLLJ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 99.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |