C38H56O4 — CID 124898646
[(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 124898646) has the molecular formula C38H56O4 and a molecular weight of 576.86 g/mol. Its IUPAC name is [(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 124898646 |
| Molecular Formula | C38H56O4 |
| Molecular Weight | 576.86 g/mol |
| Exact Mass | 576.42 |
| IUPAC Name | [(3S,8S,9R,10R,13R,14R,17R)-10,13-dimethyl-17-octyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | CCCCCCCC[C@@H]1CC[C@@H]2[C@@H]3CC=C4C[C@@H](OC(=O)/C=C/c5ccc(OC)c(OC)c5)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C38H56O4/c1-6-7-8-9-10-11-12-28-16-18-32-31-17-15-29-26-30(21-23-38(29,3)33(31)22-24-37(28,32)2)42-36(39)20-14-27-13-19-34(40-4)35(25-27)41-5/h13-15,19-20,25,28,30-33H,6-12,16-18,21-24,26H2,1-5H3/b20-14+/t28-,30+,31+,32-,33-,37-,38+/m1/s1 |
| InChIKey | GOSYUKPWUIGIFO-ZCRYTOSTSA-N |
| XLogP | 9.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.86 |
| LogP ≤ 5 | 9.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|