C25H37BrO4 — CID 124900371
methyl (4S)-4-[(1S,3S,4R,5S,8R,9R,12R,14R,17R)-3-bromo-4,17-dimethyl-2-oxo-18-oxapentacyclo[12.3.1.01,9.04,8.012,17]octadecan-5-yl]pentanoate (PubChem CID 124900371) has the molecular formula C25H37BrO4 and a molecular weight of 481.47 g/mol. Its IUPAC name is methyl (4S)-4-[(1S,3S,4R,5S,8R,9R,12R,14R,17R)-3-bromo-4,17-dimethyl-2-oxo-18-oxapentacyclo[12.3.1.01,9.04,8.012,17]octadecan-5-yl]pentanoate.
| Compound Name | methyl (4S)-4-[(1S,3S,4R,5S,8R,9R,12R,14R,17R)-3-bromo-4,17-dimethyl-2-oxo-18-oxapentacyclo[12.3.1.01,9.04,8.012,17]octadecan-5-yl]pentanoate |
|---|---|
| PubChem CID | 124900371 |
| Molecular Formula | C25H37BrO4 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | methyl (4S)-4-[(1S,3S,4R,5S,8R,9R,12R,14R,17R)-3-bromo-4,17-dimethyl-2-oxo-18-oxapentacyclo[12.3.1.01,9.04,8.012,17]octadecan-5-yl]pentanoate |
| SMILES | COC(=O)CC[C@H](C)[C@@H]1CC[C@@H]2[C@H]3CC[C@@H]4C[C@H]5CC[C@@]4(C)[C@]3(O5)C(=O)[C@@H](Br)[C@@]21C |
| InChI | InChI=1S/C25H37BrO4/c1-14(5-10-20(27)29-4)17-8-9-18-19-7-6-15-13-16-11-12-23(15,2)25(19,30-16)22(28)21(26)24(17,18)3/h14-19,21H,5-13H2,1-4H3/t14-,15+,16+,17-,18+,19+,21+,23+,24+,25+/m0/s1 |
| InChIKey | XDHSPKUJYNEBHS-DNANMEJWSA-N |
| XLogP | 5.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|