C21H23NO5 — CID 124902229
methyl (4S,7aR,12bS)-7,9-dimethoxy-3-methyl-1,2,4,13-tetrahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7a-carboxylate (PubChem CID 124902229) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is methyl (4S,7aR,12bS)-7,9-dimethoxy-3-methyl-1,2,4,13-tetrahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7a-carboxylate.
| Compound Name | methyl (4S,7aR,12bS)-7,9-dimethoxy-3-methyl-1,2,4,13-tetrahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7a-carboxylate |
|---|---|
| PubChem CID | 124902229 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | methyl (4S,7aR,12bS)-7,9-dimethoxy-3-methyl-1,2,4,13-tetrahydro-4,12-methanobenzofuro[3,2-e]isoquinoline-7a-carboxylate |
| SMILES | COC(=O)[C@@]12Oc3c(OC)ccc4c3[C@@]13CCN(C)[C@@H](C4)C3=CC=C2OC |
| InChI | InChI=1S/C21H23NO5/c1-22-10-9-20-13-6-8-16(25-3)21(20,19(23)26-4)27-18-15(24-2)7-5-12(17(18)20)11-14(13)22/h5-8,14H,9-11H2,1-4H3/t14-,20-,21+/m0/s1 |
| InChIKey | ROOZZSFGECGYSX-SZFUDVHCSA-N |
| XLogP | 1.97 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |