C20H24ClNO5S — CID 124902189
[(4R,6S,7S,7aS,12bS)-6-chloro-9-methoxy-3,7a-dimethyl-1,2,4,6,7,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] methanesulfonate (PubChem CID 124902189) has the molecular formula C20H24ClNO5S and a molecular weight of 425.93 g/mol. Its IUPAC name is [(4R,6S,7S,7aS,12bS)-6-chloro-9-methoxy-3,7a-dimethyl-1,2,4,6,7,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] methanesulfonate.
| Compound Name | [(4R,6S,7S,7aS,12bS)-6-chloro-9-methoxy-3,7a-dimethyl-1,2,4,6,7,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] methanesulfonate |
|---|---|
| PubChem CID | 124902189 |
| Molecular Formula | C20H24ClNO5S |
| Molecular Weight | 425.93 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | [(4R,6S,7S,7aS,12bS)-6-chloro-9-methoxy-3,7a-dimethyl-1,2,4,6,7,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] methanesulfonate |
| SMILES | COc1ccc2c3c1O[C@]1(C)[C@H](OS(C)(=O)=O)[C@@H](Cl)C=C4[C@@H](C2)N(C)CC[C@]431 |
| InChI | InChI=1S/C20H24ClNO5S/c1-19-18(27-28(4,23)24)13(21)10-12-14-9-11-5-6-15(25-3)17(26-19)16(11)20(12,19)7-8-22(14)2/h5-6,10,13-14,18H,7-9H2,1-4H3/t13-,14+,18+,19+,20-/m0/s1 |
| InChIKey | PLEJCHVAAIVYOT-LZOZONPPSA-N |
| XLogP | 2.24 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.93 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|