C21H25NO5 — CID 124902035
[(4R,6S,7S,7aS,12bS)-6-hydroxy-9-methoxy-3,7a-dimethyl-1,2,4,6,7,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate (PubChem CID 124902035) has the molecular formula C21H25NO5 and a molecular weight of 371.43 g/mol. Its IUPAC name is [(4R,6S,7S,7aS,12bS)-6-hydroxy-9-methoxy-3,7a-dimethyl-1,2,4,6,7,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate.
| Compound Name | [(4R,6S,7S,7aS,12bS)-6-hydroxy-9-methoxy-3,7a-dimethyl-1,2,4,6,7,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
|---|---|
| PubChem CID | 124902035 |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.17 |
| IUPAC Name | [(4R,6S,7S,7aS,12bS)-6-hydroxy-9-methoxy-3,7a-dimethyl-1,2,4,6,7,13-hexahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl] acetate |
| SMILES | COc1ccc2c3c1O[C@]1(C)[C@@H](OC(C)=O)[C@@H](O)C=C4[C@@H](C2)N(C)CC[C@]431 |
| InChI | InChI=1S/C21H25NO5/c1-11(23)26-19-15(24)10-13-14-9-12-5-6-16(25-4)18-17(12)21(13,7-8-22(14)3)20(19,2)27-18/h5-6,10,14-15,19,24H,7-9H2,1-4H3/t14-,15+,19+,20-,21+/m1/s1 |
| InChIKey | LQIKGKFOKAXCRM-SOCIYPEWSA-N |
| XLogP | 1.58 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|