C26H35NO4 — CID 124902371
(1R,2S,6R,7R,14S,15R,19R)-7-ethyl-19-(2-hydroxypropan-2-yl)-15-methoxy-5,14-dimethyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-ol (PubChem CID 124902371) has the molecular formula C26H35NO4 and a molecular weight of 425.57 g/mol. Its IUPAC name is (1R,2S,6R,7R,14S,15R,19R)-7-ethyl-19-(2-hydroxypropan-2-yl)-15-methoxy-5,14-dimethyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-ol.
| Compound Name | (1R,2S,6R,7R,14S,15R,19R)-7-ethyl-19-(2-hydroxypropan-2-yl)-15-methoxy-5,14-dimethyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-ol |
|---|---|
| PubChem CID | 124902371 |
| Molecular Formula | C26H35NO4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.26 |
| IUPAC Name | (1R,2S,6R,7R,14S,15R,19R)-7-ethyl-19-(2-hydroxypropan-2-yl)-15-methoxy-5,14-dimethyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,16-tetraen-11-ol |
| SMILES | CC[C@@H]1c2ccc(O)c3c2[C@]24CCN(C)[C@H]1[C@]21C=C[C@@](OC)([C@@H](C(C)(C)O)C1)[C@@]4(C)O3 |
| InChI | InChI=1S/C26H35NO4/c1-7-15-16-8-9-17(28)20-19(16)25-12-13-27(5)21(15)24(25)10-11-26(30-6,23(25,4)31-20)18(14-24)22(2,3)29/h8-11,15,18,21,28-29H,7,12-14H2,1-6H3/t15-,18-,21-,23+,24-,25+,26-/m1/s1 |
| InChIKey | WFNORGSBXRKKDN-GVKMAPOVSA-N |
| XLogP | 3.72 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|