C22H23NO5 — CID 98105688
(1S,2R,5R,6S,10S,18S)-13-hydroxy-5-methoxy-19-methyl-8,11-dioxa-19-azaheptacyclo[10.9.1.12,6.01,10.02,18.05,10.016,22]tricosa-3,12,14,16(22)-tetraen-7-one (PubChem CID 98105688) has the molecular formula C22H23NO5 and a molecular weight of 381.43 g/mol. Its IUPAC name is (1S,2R,5R,6S,10S,18S)-13-hydroxy-5-methoxy-19-methyl-8,11-dioxa-19-azaheptacyclo[10.9.1.12,6.01,10.02,18.05,10.016,22]tricosa-3,12,14,16(22)-tetraen-7-one.
| Compound Name | (1S,2R,5R,6S,10S,18S)-13-hydroxy-5-methoxy-19-methyl-8,11-dioxa-19-azaheptacyclo[10.9.1.12,6.01,10.02,18.05,10.016,22]tricosa-3,12,14,16(22)-tetraen-7-one |
|---|---|
| PubChem CID | 98105688 |
| Molecular Formula | C22H23NO5 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | (1S,2R,5R,6S,10S,18S)-13-hydroxy-5-methoxy-19-methyl-8,11-dioxa-19-azaheptacyclo[10.9.1.12,6.01,10.02,18.05,10.016,22]tricosa-3,12,14,16(22)-tetraen-7-one |
| SMILES | CO[C@]12C=C[C@]34C[C@@H]1C(=O)OC[C@]21Oc2c(O)ccc5c2[C@@]13CCN(C)[C@H]4C5 |
| InChI | InChI=1S/C22H23NO5/c1-23-8-7-20-16-12-3-4-14(24)17(16)28-22(20)11-27-18(25)13-10-19(20,15(23)9-12)5-6-21(13,22)26-2/h3-6,13,15,24H,7-11H2,1-2H3/t13-,15+,19-,20-,21-,22-/m1/s1 |
| InChIKey | WFQIQPANLTTYHP-LSZIHMHISA-N |
| XLogP | 1.54 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|