C27H37NO4 — CID 98105642
2-[(1R,2S,6S,7S,14R,15R,16R)-7-ethyl-11,15-dimethoxy-5,14-dimethyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]propan-2-ol (PubChem CID 98105642) has the molecular formula C27H37NO4 and a molecular weight of 439.60 g/mol. Its IUPAC name is 2-[(1R,2S,6S,7S,14R,15R,16R)-7-ethyl-11,15-dimethoxy-5,14-dimethyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]propan-2-ol.
| Compound Name | 2-[(1R,2S,6S,7S,14R,15R,16R)-7-ethyl-11,15-dimethoxy-5,14-dimethyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]propan-2-ol |
|---|---|
| PubChem CID | 98105642 |
| Molecular Formula | C27H37NO4 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.27 |
| IUPAC Name | 2-[(1R,2S,6S,7S,14R,15R,16R)-7-ethyl-11,15-dimethoxy-5,14-dimethyl-13-oxa-5-azahexacyclo[13.2.2.12,8.01,6.02,14.012,20]icosa-8(20),9,11,18-tetraen-16-yl]propan-2-ol |
| SMILES | CC[C@H]1c2ccc(OC)c3c2[C@]24CCN(C)[C@@H]1[C@]21C=C[C@@](OC)([C@@H](C(C)(C)O)C1)[C@]4(C)O3 |
| InChI | InChI=1S/C27H37NO4/c1-8-16-17-9-10-18(30-6)21-20(17)26-13-14-28(5)22(16)25(26)11-12-27(31-7,24(26,4)32-21)19(15-25)23(2,3)29/h9-12,16,19,22,29H,8,13-15H2,1-7H3/t16-,19+,22-,24+,25+,26-,27+/m0/s1 |
| InChIKey | CQJSMSATJDJBEL-QBOIPDQRSA-N |
| XLogP | 4.03 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|