C30H52O6 — CID 124903807
(2S,3S,5S,10R,12S,13R,14R,17S)-4,4,10,13,14-pentamethyl-17-[(2S,5R)-1,5,6-trihydroxy-6-methylheptan-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,12-triol (PubChem CID 124903807) has the molecular formula C30H52O6 and a molecular weight of 508.74 g/mol. Its IUPAC name is (2S,3S,5S,10R,12S,13R,14R,17S)-4,4,10,13,14-pentamethyl-17-[(2S,5R)-1,5,6-trihydroxy-6-methylheptan-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,12-triol.
| Compound Name | (2S,3S,5S,10R,12S,13R,14R,17S)-4,4,10,13,14-pentamethyl-17-[(2S,5R)-1,5,6-trihydroxy-6-methylheptan-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,12-triol |
|---|---|
| PubChem CID | 124903807 |
| Molecular Formula | C30H52O6 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.38 |
| IUPAC Name | (2S,3S,5S,10R,12S,13R,14R,17S)-4,4,10,13,14-pentamethyl-17-[(2S,5R)-1,5,6-trihydroxy-6-methylheptan-2-yl]-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,12-triol |
| SMILES | CC(C)(O)[C@H](O)CC[C@H](CO)[C@@H]1CC[C@]2(C)C3=C(C[C@H](O)[C@]12C)[C@]1(C)C[C@H](O)[C@@H](O)C(C)(C)[C@H]1CC3 |
| InChI | InChI=1S/C30H52O6/c1-26(2)22-10-9-19-20(28(22,5)15-21(32)25(26)35)14-24(34)30(7)18(12-13-29(19,30)6)17(16-31)8-11-23(33)27(3,4)36/h17-18,21-25,31-36H,8-16H2,1-7H3/t17-,18+,21+,22-,23-,24+,25-,28+,29-,30+/m1/s1 |
| InChIKey | YRXIDKUVBPMNRA-PBFWBJQUSA-N |
| XLogP | 3.56 |
| TPSA | 121.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|