C30H48O5 — CID 163044056
17-(7,7-dimethyl-6,8-dioxabicyclo[3.2.1]octan-4-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,12-triol (PubChem CID 163044056) has the molecular formula C30H48O5 and a molecular weight of 488.71 g/mol. Its IUPAC name is 17-(7,7-dimethyl-6,8-dioxabicyclo[3.2.1]octan-4-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,12-triol.
| Compound Name | 17-(7,7-dimethyl-6,8-dioxabicyclo[3.2.1]octan-4-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,12-triol |
|---|---|
| PubChem CID | 163044056 |
| Molecular Formula | C30H48O5 |
| Molecular Weight | 488.71 g/mol |
| Exact Mass | 488.35 |
| IUPAC Name | 17-(7,7-dimethyl-6,8-dioxabicyclo[3.2.1]octan-4-yl)-4,4,10,13,14-pentamethyl-2,3,5,6,7,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthrene-2,3,12-triol |
| SMILES | CC1(C)OC2OC1CCC2C1CCC2(C)C3=C(CC(O)C12C)C1(C)CC(O)C(O)C(C)(C)C1CC3 |
| InChI | InChI=1S/C30H48O5/c1-26(2)21-10-9-18-19(28(21,5)15-20(31)24(26)33)14-22(32)30(7)17(12-13-29(18,30)6)16-8-11-23-27(3,4)35-25(16)34-23/h16-17,20-25,31-33H,8-15H2,1-7H3 |
| InChIKey | MAOPXKOUHOGVSD-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.71 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|