C38H60O8 — CID 162906987
3-[7-(3-butoxy-3-oxopropanoyl)oxy-15-hydroxy-1,6,6,10,17,21-hexamethyl-14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicos-2(11)-en-15-yl]-2-methylbutanoic acid (PubChem CID 162906987) has the molecular formula C38H60O8 and a molecular weight of 644.89 g/mol. Its IUPAC name is 3-[7-(3-butoxy-3-oxopropanoyl)oxy-15-hydroxy-1,6,6,10,17,21-hexamethyl-14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicos-2(11)-en-15-yl]-2-methylbutanoic acid.
| Compound Name | 3-[7-(3-butoxy-3-oxopropanoyl)oxy-15-hydroxy-1,6,6,10,17,21-hexamethyl-14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicos-2(11)-en-15-yl]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 162906987 |
| Molecular Formula | C38H60O8 |
| Molecular Weight | 644.89 g/mol |
| Exact Mass | 644.43 |
| IUPAC Name | 3-[7-(3-butoxy-3-oxopropanoyl)oxy-15-hydroxy-1,6,6,10,17,21-hexamethyl-14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicos-2(11)-en-15-yl]-2-methylbutanoic acid |
| SMILES | CCCCOC(=O)CC(=O)OC1CCC2(C)C3=C(CCC2C1(C)C)C1(C)CCC2C(C)CC(O)(C(C)C(C)C(=O)O)OC(C3)C21C |
| InChI | InChI=1S/C38H60O8/c1-10-11-18-44-31(39)20-32(40)45-29-15-16-35(7)27-19-30-37(9)25(22(2)21-38(43,46-30)24(4)23(3)33(41)42)14-17-36(37,8)26(27)12-13-28(35)34(29,5)6/h22-25,28-30,43H,10-21H2,1-9H3,(H,41,42) |
| InChIKey | BMOGLDJYNKJONY-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.89 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|