C32H39N3O12S — CID 124904711
[(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-[(Z)-[(4-ethoxyphenyl)methylcarbamothioylhydrazinylidene]methyl]-2-methoxyphenoxy]oxan-2-yl]methyl acetate (PubChem CID 124904711) has the molecular formula C32H39N3O12S and a molecular weight of 689.74 g/mol. Its IUPAC name is [(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-[(Z)-[(4-ethoxyphenyl)methylcarbamothioylhydrazinylidene]methyl]-2-methoxyphenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-[(Z)-[(4-ethoxyphenyl)methylcarbamothioylhydrazinylidene]methyl]-2-methoxyphenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 124904711 |
| Molecular Formula | C32H39N3O12S |
| Molecular Weight | 689.74 g/mol |
| Exact Mass | 689.23 |
| IUPAC Name | [(2S,3S,4R,5S,6R)-3,4,5-triacetyloxy-6-[4-[(Z)-[(4-ethoxyphenyl)methylcarbamothioylhydrazinylidene]methyl]-2-methoxyphenoxy]oxan-2-yl]methyl acetate |
| SMILES | CCOc1ccc(CNC(=S)N/N=C\c2ccc(O[C@H]3O[C@@H](COC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]3OC(C)=O)c(OC)c2)cc1 |
| InChI | InChI=1S/C32H39N3O12S/c1-7-41-24-11-8-22(9-12-24)15-33-32(48)35-34-16-23-10-13-25(26(14-23)40-6)46-31-30(45-21(5)39)29(44-20(4)38)28(43-19(3)37)27(47-31)17-42-18(2)36/h8-14,16,27-31H,7,15,17H2,1-6H3,(H2,33,35,48)/b34-16-/t27-,28-,29+,30-,31-/m0/s1 |
| InChIKey | LMEYGSGIHMKOPL-BKWSZORSSA-N |
| XLogP | 2.55 |
| TPSA | 178.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.74 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|