C24H31N3O11S — CID 162677296
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[(2E)-2-(carbamothioylhydrazinylidene)ethyl]-2-methoxyphenoxy]oxan-2-yl]methyl acetate (PubChem CID 162677296) has the molecular formula C24H31N3O11S and a molecular weight of 569.59 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[(2E)-2-(carbamothioylhydrazinylidene)ethyl]-2-methoxyphenoxy]oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[(2E)-2-(carbamothioylhydrazinylidene)ethyl]-2-methoxyphenoxy]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 162677296 |
| Molecular Formula | C24H31N3O11S |
| Molecular Weight | 569.59 g/mol |
| Exact Mass | 569.17 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[4-[(2E)-2-(carbamothioylhydrazinylidene)ethyl]-2-methoxyphenoxy]oxan-2-yl]methyl acetate |
| SMILES | COc1cc(C/C=N/NC(N)=S)ccc1O[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H31N3O11S/c1-12(28)33-11-19-20(34-13(2)29)21(35-14(3)30)22(36-15(4)31)23(38-19)37-17-7-6-16(10-18(17)32-5)8-9-26-27-24(25)39/h6-7,9-10,19-23H,8,11H2,1-5H3,(H3,25,27,39)/b26-9+/t19-,20+,21+,22-,23-/m1/s1 |
| InChIKey | AVLTXTDPYHGIAM-HLKKZYAHSA-N |
| XLogP | 0.52 |
| TPSA | 183.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.59 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|