C7H7N5O — CID 124907820
imidazo[1,2-a]pyrazine-8-carbohydrazide (PubChem CID 124907820) has the molecular formula C7H7N5O and a molecular weight of 177.17 g/mol. Its IUPAC name is imidazo[1,2-a]pyrazine-8-carbohydrazide.
| Compound Name | imidazo[1,2-a]pyrazine-8-carbohydrazide |
|---|---|
| PubChem CID | 124907820 |
| Molecular Formula | C7H7N5O |
| Molecular Weight | 177.17 g/mol |
| Exact Mass | 177.07 |
| IUPAC Name | imidazo[1,2-a]pyrazine-8-carbohydrazide |
| SMILES | NNC(=O)c1nccn2ccnc12 |
| InChI | InChI=1S/C7H7N5O/c8-11-7(13)5-6-10-2-4-12(6)3-1-9-5/h1-4H,8H2,(H,11,13) |
| InChIKey | GJZCKOUBLYKOTC-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.17 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|