C17H23N5O — CID 75423018
N-[1-(3-methylbut-2-enyl)piperidin-4-yl]imidazo[1,2-a]pyrazine-8-carboxamide (PubChem CID 75423018) has the molecular formula C17H23N5O and a molecular weight of 313.40 g/mol. Its IUPAC name is N-[1-(3-methylbut-2-enyl)piperidin-4-yl]imidazo[1,2-a]pyrazine-8-carboxamide.
| Compound Name | N-[1-(3-methylbut-2-enyl)piperidin-4-yl]imidazo[1,2-a]pyrazine-8-carboxamide |
|---|---|
| PubChem CID | 75423018 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | N-[1-(3-methylbut-2-enyl)piperidin-4-yl]imidazo[1,2-a]pyrazine-8-carboxamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)c2nccn3ccnc23)CC1 |
| InChI | InChI=1S/C17H23N5O/c1-13(2)3-8-21-9-4-14(5-10-21)20-17(23)15-16-19-7-12-22(16)11-6-18-15/h3,6-7,11-12,14H,4-5,8-10H2,1-2H3,(H,20,23) |
| InChIKey | NDWXUJXQGOPXEJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|