C25H30N4O2 — CID 56569173
3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]benzamide (PubChem CID 56569173) has the molecular formula C25H30N4O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]benzamide.
| Compound Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 56569173 |
| Molecular Formula | C25H30N4O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | 3-(imidazo[1,2-a]pyridin-2-ylmethoxy)-N-[1-(3-methylbut-2-enyl)piperidin-4-yl]benzamide |
| SMILES | CC(C)=CCN1CCC(NC(=O)c2cccc(OCc3cn4ccccc4n3)c2)CC1 |
| InChI | InChI=1S/C25H30N4O2/c1-19(2)9-13-28-14-10-21(11-15-28)27-25(30)20-6-5-7-23(16-20)31-18-22-17-29-12-4-3-8-24(29)26-22/h3-9,12,16-17,21H,10-11,13-15,18H2,1-2H3,(H,27,30) |
| InChIKey | DEHJZPNPUGFLDZ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|