C27H24F6N2O — CID 124914256
4-[(R)-[2,4-bis(trifluoromethyl)phenoxy]-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinoline (PubChem CID 124914256) has the molecular formula C27H24F6N2O and a molecular weight of 506.49 g/mol. Its IUPAC name is 4-[(R)-[2,4-bis(trifluoromethyl)phenoxy]-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinoline.
| Compound Name | 4-[(R)-[2,4-bis(trifluoromethyl)phenoxy]-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinoline |
|---|---|
| PubChem CID | 124914256 |
| Molecular Formula | C27H24F6N2O |
| Molecular Weight | 506.49 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | 4-[(R)-[2,4-bis(trifluoromethyl)phenoxy]-[(2S,4S,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinoline |
| SMILES | C=C[C@@H]1CN2CC[C@H]1C[C@H]2[C@H](Oc1ccc(C(F)(F)F)cc1C(F)(F)F)c1ccnc2ccccc12 |
| InChI | InChI=1S/C27H24F6N2O/c1-2-16-15-35-12-10-17(16)13-23(35)25(20-9-11-34-22-6-4-3-5-19(20)22)36-24-8-7-18(26(28,29)30)14-21(24)27(31,32)33/h2-9,11,14,16-17,23,25H,1,10,12-13,15H2/t16-,17+,23+,25-/m1/s1 |
| InChIKey | KRIUSPRNDMKGFR-FPSPRXFKSA-N |
| XLogP | 7.29 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.49 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|