C33H32F3N3O — CID 146165014
4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-phenylmethoxymethyl]-N-[4-(trifluoromethyl)phenyl]quinolin-6-amine (PubChem CID 146165014) has the molecular formula C33H32F3N3O and a molecular weight of 543.63 g/mol. Its IUPAC name is 4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-phenylmethoxymethyl]-N-[4-(trifluoromethyl)phenyl]quinolin-6-amine.
| Compound Name | 4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-phenylmethoxymethyl]-N-[4-(trifluoromethyl)phenyl]quinolin-6-amine |
|---|---|
| PubChem CID | 146165014 |
| Molecular Formula | C33H32F3N3O |
| Molecular Weight | 543.63 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 4-[(R)-(5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl)-phenylmethoxymethyl]-N-[4-(trifluoromethyl)phenyl]quinolin-6-amine |
| SMILES | C=CC1CN2CCC1CC2[C@H](OCc1ccccc1)c1ccnc2ccc(Nc3ccc(C(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C33H32F3N3O/c1-2-23-20-39-17-15-24(23)18-31(39)32(40-21-22-6-4-3-5-7-22)28-14-16-37-30-13-12-27(19-29(28)30)38-26-10-8-25(9-11-26)33(34,35)36/h2-14,16,19,23-24,31-32,38H,1,15,17-18,20-21H2/t23?,24?,31?,32-/m1/s1 |
| InChIKey | AJPOIRWUUGLFBM-NQSPBDJXSA-N |
| XLogP | 8.15 |
| TPSA | 37.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.63 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|