C30H30N2O2 — CID 53309625
4-[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(naphthalen-1-ylmethoxy)methyl]quinolin-6-ol (PubChem CID 53309625) has the molecular formula C30H30N2O2 and a molecular weight of 450.58 g/mol. Its IUPAC name is 4-[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(naphthalen-1-ylmethoxy)methyl]quinolin-6-ol.
| Compound Name | 4-[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(naphthalen-1-ylmethoxy)methyl]quinolin-6-ol |
|---|---|
| PubChem CID | 53309625 |
| Molecular Formula | C30H30N2O2 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.23 |
| IUPAC Name | 4-[(S)-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-(naphthalen-1-ylmethoxy)methyl]quinolin-6-ol |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](OCc1cccc2ccccc12)c1ccnc2ccc(O)cc12 |
| InChI | InChI=1S/C30H30N2O2/c1-2-20-18-32-15-13-22(20)16-29(32)30(26-12-14-31-28-11-10-24(33)17-27(26)28)34-19-23-8-5-7-21-6-3-4-9-25(21)23/h2-12,14,17,20,22,29-30,33H,1,13,15-16,18-19H2/t20-,22-,29+,30-/m0/s1 |
| InChIKey | QLOHWTGSVUMFPG-SIWWEPCFSA-N |
| XLogP | 6.25 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|