C34H32N2O2 — CID 164681191
4-[(S)-anthracen-9-ylmethoxy-[(2R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol (PubChem CID 164681191) has the molecular formula C34H32N2O2 and a molecular weight of 500.64 g/mol. Its IUPAC name is 4-[(S)-anthracen-9-ylmethoxy-[(2R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol.
| Compound Name | 4-[(S)-anthracen-9-ylmethoxy-[(2R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol |
|---|---|
| PubChem CID | 164681191 |
| Molecular Formula | C34H32N2O2 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 4-[(S)-anthracen-9-ylmethoxy-[(2R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol |
| SMILES | C=CC1CN2CCC1C[C@@H]2[C@@H](OCc1c2ccccc2cc2ccccc12)c1ccnc2ccc(O)cc12 |
| InChI | InChI=1S/C34H32N2O2/c1-2-22-20-36-16-14-23(22)18-33(36)34(29-13-15-35-32-12-11-26(37)19-30(29)32)38-21-31-27-9-5-3-7-24(27)17-25-8-4-6-10-28(25)31/h2-13,15,17,19,22-23,33-34,37H,1,14,16,18,20-21H2/t22?,23?,33-,34+/m1/s1 |
| InChIKey | WBYFLUOCEBOKRM-KQDLNTTESA-N |
| XLogP | 7.40 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|