C27H29NO2 — CID 137284911
8-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]naphthalen-2-ol (PubChem CID 137284911) has the molecular formula C27H29NO2 and a molecular weight of 399.53 g/mol. Its IUPAC name is 8-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]naphthalen-2-ol.
| Compound Name | 8-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]naphthalen-2-ol |
|---|---|
| PubChem CID | 137284911 |
| Molecular Formula | C27H29NO2 |
| Molecular Weight | 399.53 g/mol |
| Exact Mass | 399.22 |
| IUPAC Name | 8-[(S)-[(2S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]naphthalen-2-ol |
| SMILES | C=CC1CN2CCC1C[C@H]2[C@@H](OCc1ccccc1)c1cccc2ccc(O)cc12 |
| InChI | InChI=1S/C27H29NO2/c1-2-20-17-28-14-13-22(20)15-26(28)27(30-18-19-7-4-3-5-8-19)24-10-6-9-21-11-12-23(29)16-25(21)24/h2-12,16,20,22,26-27,29H,1,13-15,17-18H2/t20?,22?,26-,27-/m0/s1 |
| InChIKey | RLKUUUOERNVEIR-KFFAGCAXSA-N |
| XLogP | 5.70 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.53 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|