C35H32F6N4OS — CID 132600850
1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinolin-6-yl]thiourea (PubChem CID 132600850) has the molecular formula C35H32F6N4OS and a molecular weight of 670.72 g/mol. Its IUPAC name is 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinolin-6-yl]thiourea.
| Compound Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinolin-6-yl]thiourea |
|---|---|
| PubChem CID | 132600850 |
| Molecular Formula | C35H32F6N4OS |
| Molecular Weight | 670.72 g/mol |
| Exact Mass | 670.22 |
| IUPAC Name | 1-[3,5-bis(trifluoromethyl)phenyl]-3-[4-[(S)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-phenylmethoxymethyl]quinolin-6-yl]thiourea |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@@H](OCc1ccccc1)c1ccnc2ccc(NC(=S)Nc3cc(C(F)(F)F)cc(C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C35H32F6N4OS/c1-2-22-19-45-13-11-23(22)14-31(45)32(46-20-21-6-4-3-5-7-21)28-10-12-42-30-9-8-26(18-29(28)30)43-33(47)44-27-16-24(34(36,37)38)15-25(17-27)35(39,40)41/h2-10,12,15-18,22-23,31-32H,1,11,13-14,19-20H2,(H2,43,44,47)/t22-,23-,31-,32-/m0/s1 |
| InChIKey | VTFCTIIECOTHPV-IECLFQADSA-N |
| XLogP | 9.24 |
| TPSA | 49.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 670.72 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|