C30H36N2O2 — CID 50922952
4-[(S)-(4-tert-butylphenyl)methoxy-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol (PubChem CID 50922952) has the molecular formula C30H36N2O2 and a molecular weight of 456.63 g/mol. Its IUPAC name is 4-[(S)-(4-tert-butylphenyl)methoxy-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol.
| Compound Name | 4-[(S)-(4-tert-butylphenyl)methoxy-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol |
|---|---|
| PubChem CID | 50922952 |
| Molecular Formula | C30H36N2O2 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.28 |
| IUPAC Name | 4-[(S)-(4-tert-butylphenyl)methoxy-[(2R,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinolin-6-ol |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@@H]2[C@@H](OCc1ccc(C(C)(C)C)cc1)c1ccnc2ccc(O)cc12 |
| InChI | InChI=1S/C30H36N2O2/c1-5-21-18-32-15-13-22(21)16-28(32)29(25-12-14-31-27-11-10-24(33)17-26(25)27)34-19-20-6-8-23(9-7-20)30(2,3)4/h5-12,14,17,21-22,28-29,33H,1,13,15-16,18-19H2,2-4H3/t21-,22-,28+,29-/m0/s1 |
| InChIKey | FAGHOPSANRASSJ-RGTUZWOVSA-N |
| XLogP | 6.39 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|