C37H36N2O — CID 124832840
4-[(R)-[(2S)-1-anthracen-9-ylbut-3-en-2-yl]oxy-[(2S,4R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinoline (PubChem CID 124832840) has the molecular formula C37H36N2O and a molecular weight of 524.71 g/mol. Its IUPAC name is 4-[(R)-[(2S)-1-anthracen-9-ylbut-3-en-2-yl]oxy-[(2S,4R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinoline.
| Compound Name | 4-[(R)-[(2S)-1-anthracen-9-ylbut-3-en-2-yl]oxy-[(2S,4R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinoline |
|---|---|
| PubChem CID | 124832840 |
| Molecular Formula | C37H36N2O |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.28 |
| IUPAC Name | 4-[(R)-[(2S)-1-anthracen-9-ylbut-3-en-2-yl]oxy-[(2S,4R,5S)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]methyl]quinoline |
| SMILES | C=C[C@H](Cc1c2ccccc2cc2ccccc12)O[C@H](c1ccnc2ccccc12)[C@@H]1C[C@H]2CCN1C[C@H]2C=C |
| InChI | InChI=1S/C37H36N2O/c1-3-25-24-39-20-18-26(25)22-36(39)37(33-17-19-38-35-16-10-9-15-32(33)35)40-29(4-2)23-34-30-13-7-5-11-27(30)21-28-12-6-8-14-31(28)34/h3-17,19,21,25-26,29,36-37H,1-2,18,20,22-24H2/t25-,26-,29-,36+,37-/m1/s1 |
| InChIKey | JLHIGLVWIHBWSL-FBPWIKRBSA-N |
| XLogP | 8.29 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|