C33H54 — CID 124914321
(5S,8S,9R,10S,13R,14R,17S)-3-(3,3-dimethylbut-1-ynyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 124914321) has the molecular formula C33H54 and a molecular weight of 450.80 g/mol. Its IUPAC name is (5S,8S,9R,10S,13R,14R,17S)-3-(3,3-dimethylbut-1-ynyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (5S,8S,9R,10S,13R,14R,17S)-3-(3,3-dimethylbut-1-ynyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 124914321 |
| Molecular Formula | C33H54 |
| Molecular Weight | 450.80 g/mol |
| Exact Mass | 450.42 |
| IUPAC Name | (5S,8S,9R,10S,13R,14R,17S)-3-(3,3-dimethylbut-1-ynyl)-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | CC(C)CCC[C@@H](C)[C@@H]1CC[C@@H]2[C@H]3CC[C@H]4CC(C#CC(C)(C)C)=CC[C@]4(C)[C@@H]3CC[C@@]21C |
| InChI | InChI=1S/C33H54/c1-23(2)10-9-11-24(3)28-14-15-29-27-13-12-26-22-25(16-19-31(4,5)6)17-20-32(26,7)30(27)18-21-33(28,29)8/h17,23-24,26-30H,9-15,18,20-22H2,1-8H3/t24-,26+,27-,28+,29-,30-,32+,33-/m1/s1 |
| InChIKey | VMWUKKYHGOSZRT-NESKHNOVSA-N |
| XLogP | 9.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.80 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|