C31H55N — CID 573444
N,N-diethyl-10,13-dimethyl-17-(6-methylheptan-2-yl)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine (PubChem CID 573444) has the molecular formula C31H55N and a molecular weight of 441.79 g/mol. Its IUPAC name is N,N-diethyl-10,13-dimethyl-17-(6-methylheptan-2-yl)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine.
| Compound Name | N,N-diethyl-10,13-dimethyl-17-(6-methylheptan-2-yl)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine |
|---|---|
| PubChem CID | 573444 |
| Molecular Formula | C31H55N |
| Molecular Weight | 441.79 g/mol |
| Exact Mass | 441.43 |
| IUPAC Name | N,N-diethyl-10,13-dimethyl-17-(6-methylheptan-2-yl)-4,5,6,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3-amine |
| SMILES | CCN(CC)C1=CCC2(C)C(CCC3C2CCC2(C)C(C(C)CCCC(C)C)CCC32)C1 |
| InChI | InChI=1S/C31H55N/c1-8-32(9-2)25-17-19-30(6)24(21-25)13-14-26-28-16-15-27(23(5)12-10-11-22(3)4)31(28,7)20-18-29(26)30/h17,22-24,26-29H,8-16,18-21H2,1-7H3 |
| InChIKey | ILARLJVAKHDKKN-UHFFFAOYSA-N |
| XLogP | 8.94 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.79 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |