C8H11Br2NO — CID 124920538
(1R,3S,4R,6S)-3,4-dibromo-7-methyl-7-azabicyclo[4.2.0]octan-8-one (PubChem CID 124920538) has the molecular formula C8H11Br2NO and a molecular weight of 296.99 g/mol. Its IUPAC name is (1R,3S,4R,6S)-3,4-dibromo-7-methyl-7-azabicyclo[4.2.0]octan-8-one.
| Compound Name | (1R,3S,4R,6S)-3,4-dibromo-7-methyl-7-azabicyclo[4.2.0]octan-8-one |
|---|---|
| PubChem CID | 124920538 |
| Molecular Formula | C8H11Br2NO |
| Molecular Weight | 296.99 g/mol |
| Exact Mass | 294.92 |
| IUPAC Name | (1R,3S,4R,6S)-3,4-dibromo-7-methyl-7-azabicyclo[4.2.0]octan-8-one |
| SMILES | CN1C(=O)[C@@H]2C[C@H](Br)[C@H](Br)C[C@@H]21 |
| InChI | InChI=1S/C8H11Br2NO/c1-11-7-3-6(10)5(9)2-4(7)8(11)12/h4-7H,2-3H2,1H3/t4-,5+,6-,7+/m1/s1 |
| InChIKey | TUUZZRNQKSTHBQ-UCROKIRRSA-N |
| XLogP | 1.76 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.99 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|