C11H15Br2NO2 — CID 124924846
methyl (1S,3R,4R,6R)-3,4-dibromo-10-azatricyclo[4.3.1.01,6]decane-10-carboxylate (PubChem CID 124924846) has the molecular formula C11H15Br2NO2 and a molecular weight of 353.05 g/mol. Its IUPAC name is methyl (1S,3R,4R,6R)-3,4-dibromo-10-azatricyclo[4.3.1.01,6]decane-10-carboxylate.
| Compound Name | methyl (1S,3R,4R,6R)-3,4-dibromo-10-azatricyclo[4.3.1.01,6]decane-10-carboxylate |
|---|---|
| PubChem CID | 124924846 |
| Molecular Formula | C11H15Br2NO2 |
| Molecular Weight | 353.05 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | methyl (1S,3R,4R,6R)-3,4-dibromo-10-azatricyclo[4.3.1.01,6]decane-10-carboxylate |
| SMILES | COC(=O)N1[C@@]23CCC[C@@]12C[C@@H](Br)[C@H](Br)C3 |
| InChI | InChI=1S/C11H15Br2NO2/c1-16-9(15)14-10-3-2-4-11(10,14)6-8(13)7(12)5-10/h7-8H,2-6H2,1H3/t7-,8-,10-,11+,14?/m1/s1 |
| InChIKey | ZOCWMTAEBWJOTF-PGYAUKMFSA-N |
| XLogP | 3.05 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.05 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|