C12H17Br2NO2 — CID 98162950
methyl (1aR,2aR,6aS,7aR)-2a,6a-dibromo-1a,2,3,4,5,6,7,7a-octahydronaphtho[2,3-b]azirine-1-carboxylate (PubChem CID 98162950) has the molecular formula C12H17Br2NO2 and a molecular weight of 367.08 g/mol. Its IUPAC name is methyl (1aR,2aR,6aS,7aR)-2a,6a-dibromo-1a,2,3,4,5,6,7,7a-octahydronaphtho[2,3-b]azirine-1-carboxylate.
| Compound Name | methyl (1aR,2aR,6aS,7aR)-2a,6a-dibromo-1a,2,3,4,5,6,7,7a-octahydronaphtho[2,3-b]azirine-1-carboxylate |
|---|---|
| PubChem CID | 98162950 |
| Molecular Formula | C12H17Br2NO2 |
| Molecular Weight | 367.08 g/mol |
| Exact Mass | 364.96 |
| IUPAC Name | methyl (1aR,2aR,6aS,7aR)-2a,6a-dibromo-1a,2,3,4,5,6,7,7a-octahydronaphtho[2,3-b]azirine-1-carboxylate |
| SMILES | COC(=O)N1[C@@H]2C[C@]3(Br)CCCC[C@]3(Br)C[C@H]21 |
| InChI | InChI=1S/C12H17Br2NO2/c1-17-10(16)15-8-6-11(13)4-2-3-5-12(11,14)7-9(8)15/h8-9H,2-7H2,1H3/t8-,9-,11-,12+,15?/m1/s1 |
| InChIKey | ZUMLRTBGRDBLDA-IXIFJJFMSA-N |
| XLogP | 3.44 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.08 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|