C14H25NO3Si — CID 11822148
methyl (1R,4R,6S)-4-trimethylsilyloxy-10-azatricyclo[4.3.1.02,4]decane-10-carboxylate (PubChem CID 11822148) has the molecular formula C14H25NO3Si and a molecular weight of 283.44 g/mol. Its IUPAC name is methyl (1R,4R,6S)-4-trimethylsilyloxy-10-azatricyclo[4.3.1.02,4]decane-10-carboxylate.
| Compound Name | methyl (1R,4R,6S)-4-trimethylsilyloxy-10-azatricyclo[4.3.1.02,4]decane-10-carboxylate |
|---|---|
| PubChem CID | 11822148 |
| Molecular Formula | C14H25NO3Si |
| Molecular Weight | 283.44 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | methyl (1R,4R,6S)-4-trimethylsilyloxy-10-azatricyclo[4.3.1.02,4]decane-10-carboxylate |
| SMILES | COC(=O)N1[C@H]2CCC[C@@H]1C1C[C@@]1(O[Si](C)(C)C)C2 |
| InChI | InChI=1S/C14H25NO3Si/c1-17-13(16)15-10-6-5-7-12(15)11-9-14(11,8-10)18-19(2,3)4/h10-12H,5-9H2,1-4H3/t10-,11?,12+,14-/m0/s1 |
| InChIKey | WNRDSZBUSNGMFV-LNJHAREASA-N |
| XLogP | 2.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.44 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|