C13H23NO3Si — CID 10825871
methyl (1S,5R)-3-trimethylsilyloxy-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 10825871) has the molecular formula C13H23NO3Si and a molecular weight of 269.42 g/mol. Its IUPAC name is methyl (1S,5R)-3-trimethylsilyloxy-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | methyl (1S,5R)-3-trimethylsilyloxy-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 10825871 |
| Molecular Formula | C13H23NO3Si |
| Molecular Weight | 269.42 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | methyl (1S,5R)-3-trimethylsilyloxy-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | COC(=O)N1[C@@H]2CCC[C@H]1C=C(O[Si](C)(C)C)C2 |
| InChI | InChI=1S/C13H23NO3Si/c1-16-13(15)14-10-6-5-7-11(14)9-12(8-10)17-18(2,3)4/h8,10-11H,5-7,9H2,1-4H3/t10-,11+/m0/s1 |
| InChIKey | FOMKOQLVSMNRNI-WDEREUQCSA-N |
| XLogP | 3.12 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|