C19H33NO2 — CID 171973129
tert-butyl 3-(3,3-dimethylbutyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171973129) has the molecular formula C19H33NO2 and a molecular weight of 307.48 g/mol. Its IUPAC name is tert-butyl 3-(3,3-dimethylbutyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | tert-butyl 3-(3,3-dimethylbutyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171973129 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | tert-butyl 3-(3,3-dimethylbutyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | CC(C)(C)CCC1=CC2CCCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H33NO2/c1-18(2,3)11-10-14-12-15-8-7-9-16(13-14)20(15)17(21)22-19(4,5)6/h12,15-16H,7-11,13H2,1-6H3 |
| InChIKey | YBZYSXZRFAOABF-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|