C20H22F5NO2 — CID 171968533
tert-butyl 3-[(2,3,4,5,6-pentafluorophenyl)methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171968533) has the molecular formula C20H22F5NO2 and a molecular weight of 403.39 g/mol. Its IUPAC name is tert-butyl 3-[(2,3,4,5,6-pentafluorophenyl)methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | tert-butyl 3-[(2,3,4,5,6-pentafluorophenyl)methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171968533 |
| Molecular Formula | C20H22F5NO2 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | tert-butyl 3-[(2,3,4,5,6-pentafluorophenyl)methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(Cc3c(F)c(F)c(F)c(F)c3F)CC1CCC2 |
| InChI | InChI=1S/C20H22F5NO2/c1-20(2,3)28-19(27)26-11-5-4-6-12(26)8-10(7-11)9-13-14(21)16(23)18(25)17(24)15(13)22/h7,11-12H,4-6,8-9H2,1-3H3 |
| InChIKey | PQNWYUVPUKUIRX-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|