C20H26FNO2 — CID 171972107
tert-butyl 3-[(3-fluoro-4-methylphenyl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate (PubChem CID 171972107) has the molecular formula C20H26FNO2 and a molecular weight of 331.43 g/mol. Its IUPAC name is tert-butyl 3-[(3-fluoro-4-methylphenyl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate.
| Compound Name | tert-butyl 3-[(3-fluoro-4-methylphenyl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
|---|---|
| PubChem CID | 171972107 |
| Molecular Formula | C20H26FNO2 |
| Molecular Weight | 331.43 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | tert-butyl 3-[(3-fluoro-4-methylphenyl)methyl]-8-azabicyclo[3.2.1]oct-2-ene-8-carboxylate |
| SMILES | Cc1ccc(CC2=CC3CCC(C2)N3C(=O)OC(C)(C)C)cc1F |
| InChI | InChI=1S/C20H26FNO2/c1-13-5-6-14(12-18(13)21)9-15-10-16-7-8-17(11-15)22(16)19(23)24-20(2,3)4/h5-6,10,12,16-17H,7-9,11H2,1-4H3 |
| InChIKey | QHOXEHQSFVGUEQ-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.43 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|