C21H28FNO2 — CID 171970559
tert-butyl 3-[2-(4-fluorophenyl)ethyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171970559) has the molecular formula C21H28FNO2 and a molecular weight of 345.46 g/mol. Its IUPAC name is tert-butyl 3-[2-(4-fluorophenyl)ethyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | tert-butyl 3-[2-(4-fluorophenyl)ethyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171970559 |
| Molecular Formula | C21H28FNO2 |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | tert-butyl 3-[2-(4-fluorophenyl)ethyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(CCc3ccc(F)cc3)CC1CCC2 |
| InChI | InChI=1S/C21H28FNO2/c1-21(2,3)25-20(24)23-18-5-4-6-19(23)14-16(13-18)8-7-15-9-11-17(22)12-10-15/h9-13,18-19H,4-8,14H2,1-3H3 |
| InChIKey | DOYAXWBYROSIIX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|