C18H31NO4 — CID 171973101
tert-butyl 3-[2-(2-methoxyethoxy)ethyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171973101) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is tert-butyl 3-[2-(2-methoxyethoxy)ethyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | tert-butyl 3-[2-(2-methoxyethoxy)ethyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171973101 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | tert-butyl 3-[2-(2-methoxyethoxy)ethyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | COCCOCCC1=CC2CCCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31NO4/c1-18(2,3)23-17(20)19-15-6-5-7-16(19)13-14(12-15)8-9-22-11-10-21-4/h12,15-16H,5-11,13H2,1-4H3 |
| InChIKey | RVWHNMWOAKTSPB-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|