C22H37NO2 — CID 171970859
tert-butyl 3-non-8-enyl-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171970859) has the molecular formula C22H37NO2 and a molecular weight of 347.54 g/mol. Its IUPAC name is tert-butyl 3-non-8-enyl-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | tert-butyl 3-non-8-enyl-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171970859 |
| Molecular Formula | C22H37NO2 |
| Molecular Weight | 347.54 g/mol |
| Exact Mass | 347.28 |
| IUPAC Name | tert-butyl 3-non-8-enyl-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | C=CCCCCCCCC1=CC2CCCC(C1)N2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H37NO2/c1-5-6-7-8-9-10-11-13-18-16-19-14-12-15-20(17-18)23(19)21(24)25-22(2,3)4/h5,16,19-20H,1,6-15,17H2,2-4H3 |
| InChIKey | MIDJVKRXYAPBDD-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.54 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|