C22H31NO2 — CID 171970592
tert-butyl 3-[(2,3-dimethylphenyl)methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171970592) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is tert-butyl 3-[(2,3-dimethylphenyl)methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | tert-butyl 3-[(2,3-dimethylphenyl)methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171970592 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | tert-butyl 3-[(2,3-dimethylphenyl)methyl]-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | Cc1cccc(CC2=CC3CCCC(C2)N3C(=O)OC(C)(C)C)c1C |
| InChI | InChI=1S/C22H31NO2/c1-15-8-6-9-18(16(15)2)12-17-13-19-10-7-11-20(14-17)23(19)21(24)25-22(3,4)5/h6,8-9,13,19-20H,7,10-12,14H2,1-5H3 |
| InChIKey | DDCSKEBOKDGDRR-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|