C17H21N3O3S — CID 124926749
[2-[[4-(dimethylamino)phenyl]methylideneamino]phenyl] N,N-dimethylsulfamate (PubChem CID 124926749) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is [2-[[4-(dimethylamino)phenyl]methylideneamino]phenyl] N,N-dimethylsulfamate.
| Compound Name | [2-[[4-(dimethylamino)phenyl]methylideneamino]phenyl] N,N-dimethylsulfamate |
|---|---|
| PubChem CID | 124926749 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | [2-[[4-(dimethylamino)phenyl]methylideneamino]phenyl] N,N-dimethylsulfamate |
| SMILES | CN(C)c1ccc(/C=N/c2ccccc2OS(=O)(=O)N(C)C)cc1 |
| InChI | InChI=1S/C17H21N3O3S/c1-19(2)15-11-9-14(10-12-15)13-18-16-7-5-6-8-17(16)23-24(21,22)20(3)4/h5-13H,1-4H3/b18-13+ |
| InChIKey | LEISAOMMMFURNS-QGOAFFKASA-N |
| XLogP | 2.69 |
| TPSA | 62.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|