C8H11N2NaO5S2 — CID 88679243
sodium [2-(dimethylsulfamoyloxy)phenyl]sulfonylazanide (PubChem CID 88679243) has the molecular formula C8H11N2NaO5S2 and a molecular weight of 302.31 g/mol. Its IUPAC name is sodium [2-(dimethylsulfamoyloxy)phenyl]sulfonylazanide.
| Compound Name | sodium [2-(dimethylsulfamoyloxy)phenyl]sulfonylazanide |
|---|---|
| PubChem CID | 88679243 |
| Molecular Formula | C8H11N2NaO5S2 |
| Molecular Weight | 302.31 g/mol |
| Exact Mass | 302.00 |
| IUPAC Name | sodium [2-(dimethylsulfamoyloxy)phenyl]sulfonylazanide |
| SMILES | CN(C)S(=O)(=O)Oc1ccccc1S([NH-])(=O)=O.[Na+] |
| InChI | InChI=1S/C8H11N2O5S2.Na/c1-10(2)17(13,14)15-7-5-3-4-6-8(7)16(9,11)12;/h3-6H,1-2H3,(H-,9,11,12);/q-1;+1 |
| InChIKey | URJBTWVGKHVRBL-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 104.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.31 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |