C12H19NO3S — CID 23557573
(3-tert-butylphenyl) N,N-dimethylsulfamate (PubChem CID 23557573) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is (3-tert-butylphenyl) N,N-dimethylsulfamate.
| Compound Name | (3-tert-butylphenyl) N,N-dimethylsulfamate |
|---|---|
| PubChem CID | 23557573 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | (3-tert-butylphenyl) N,N-dimethylsulfamate |
| SMILES | CN(C)S(=O)(=O)Oc1cccc(C(C)(C)C)c1 |
| InChI | InChI=1S/C12H19NO3S/c1-12(2,3)10-7-6-8-11(9-10)16-17(14,15)13(4)5/h6-9H,1-5H3 |
| InChIKey | JGMGLKQQUVXLGZ-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |