C10H15NO5S — CID 118351208
(3,5-dimethoxyphenyl) N,N-dimethylsulfamate (PubChem CID 118351208) has the molecular formula C10H15NO5S and a molecular weight of 261.30 g/mol. Its IUPAC name is (3,5-dimethoxyphenyl) N,N-dimethylsulfamate.
| Compound Name | (3,5-dimethoxyphenyl) N,N-dimethylsulfamate |
|---|---|
| PubChem CID | 118351208 |
| Molecular Formula | C10H15NO5S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.07 |
| IUPAC Name | (3,5-dimethoxyphenyl) N,N-dimethylsulfamate |
| SMILES | COc1cc(OC)cc(OS(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C10H15NO5S/c1-11(2)17(12,13)16-10-6-8(14-3)5-9(7-10)15-4/h5-7H,1-4H3 |
| InChIKey | VNPPBQNMEQNSHR-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |