C12H19NO2 — CID 129265137
3,5-dimethoxy-N-methyl-N-propan-2-ylaniline (PubChem CID 129265137) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 3,5-dimethoxy-N-methyl-N-propan-2-ylaniline.
| Compound Name | 3,5-dimethoxy-N-methyl-N-propan-2-ylaniline |
|---|---|
| PubChem CID | 129265137 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 3,5-dimethoxy-N-methyl-N-propan-2-ylaniline |
| SMILES | COc1cc(OC)cc(N(C)C(C)C)c1 |
| InChI | InChI=1S/C12H19NO2/c1-9(2)13(3)10-6-11(14-4)8-12(7-10)15-5/h6-9H,1-5H3 |
| InChIKey | NQWQKELDWGVXQV-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |