About 2-phenylpropan-2-yl N,N-dimethylsulfamate
2-phenylpropan-2-yl N,N-dimethylsulfamate (PubChem CID 54182961) has the molecular formula C11H17NO3S
and a molecular weight of 243.33 g/mol. Its IUPAC name is 2-phenylpropan-2-yl N,N-dimethylsulfamate.
Molecular Properties
| Compound Name | 2-phenylpropan-2-yl N,N-dimethylsulfamate |
| PubChem CID | 54182961 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 2-phenylpropan-2-yl N,N-dimethylsulfamate |
| SMILES | CN(C)S(=O)(=O)OC(C)(C)c1ccccc1 |
| InChI | InChI=1S/C11H17NO3S/c1-11(2,10-8-6-5-7-9-10)15-16(13,14)12(3)4/h5-9H,1-4H3 |
| InChIKey | PDDKSNXCUBJSDR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-phenylpropan-2-yl N,N-dimethylsulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropan-2-yl N,N-dimethylsulfamate?
The IUPAC name of 2-phenylpropan-2-yl N,N-dimethylsulfamate (CID 54182961) is 2-phenylpropan-2-yl N,N-dimethylsulfamate.
What is the SMILES notation for 2-phenylpropan-2-yl N,N-dimethylsulfamate?
The canonical SMILES for 2-phenylpropan-2-yl N,N-dimethylsulfamate is CN(C)S(=O)(=O)OC(C)(C)c1ccccc1.
What is the InChIKey of 2-phenylpropan-2-yl N,N-dimethylsulfamate?
The InChIKey is PDDKSNXCUBJSDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17NO3S/c1-11(2,10-8-6-5-7-9-10)15-16(13,14)12(3)4/h5-9H,1-4H3.
What are the key properties of 2-phenylpropan-2-yl N,N-dimethylsulfamate?
2-phenylpropan-2-yl N,N-dimethylsulfamate has a molecular weight of 243.33 g/mol, XLogP of 1.74, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropan-2-yl N,N-dimethylsulfamate is sourced from PubChem (CID 54182961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).